C7H12BrN3O2 — CID 58481307
1-(2-azidoethoxy)-3-bromo-3-methylbutan-2-one (PubChem CID 58481307) has the molecular formula C7H12BrN3O2 and a molecular weight of 250.10 g/mol. Its IUPAC name is 1-(2-azidoethoxy)-3-bromo-3-methylbutan-2-one.
| Compound Name | 1-(2-azidoethoxy)-3-bromo-3-methylbutan-2-one |
|---|---|
| PubChem CID | 58481307 |
| Molecular Formula | C7H12BrN3O2 |
| Molecular Weight | 250.10 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 1-(2-azidoethoxy)-3-bromo-3-methylbutan-2-one |
| SMILES | CC(C)(Br)C(=O)COCCN=[N+]=[N-] |
| InChI | InChI=1S/C7H12BrN3O2/c1-7(2,8)6(12)5-13-4-3-10-11-9/h3-5H2,1-2H3 |
| InChIKey | WBHAUICNGXDDEB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.10 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|