C7H13N3O4 — CID 16723228
methyl 2-[2-(2-azidoethoxy)ethoxy]acetate (PubChem CID 16723228) has the molecular formula C7H13N3O4 and a molecular weight of 203.20 g/mol. Its IUPAC name is methyl 2-[2-(2-azidoethoxy)ethoxy]acetate.
| Compound Name | methyl 2-[2-(2-azidoethoxy)ethoxy]acetate |
|---|---|
| PubChem CID | 16723228 |
| Molecular Formula | C7H13N3O4 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | methyl 2-[2-(2-azidoethoxy)ethoxy]acetate |
| SMILES | COC(=O)COCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C7H13N3O4/c1-12-7(11)6-14-5-4-13-3-2-9-10-8/h2-6H2,1H3 |
| InChIKey | POTKFKYTYYJXHI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|