methyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate

C10H18O7 — CID 4170388

IUPACmethyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate
SMILESCOC(=O)COCCOCCOCC(=O)OC
InChIInChI=1S/C10H18O7/c1-13-9(11)7-16-5-3-15-4-6-17-8-10(12)14-2/h3-8H2,1-2H3
InChIKeyYKVQKHKEOTVVCM-UHFFFAOYSA-N
MW250.25 g/mol
LogP-0.62
Rot. Bonds10

About methyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate

methyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate (PubChem CID 4170388) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is methyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate.

Molecular Properties

Compound Namemethyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate
PubChem CID4170388
Molecular FormulaC10H18O7
Molecular Weight250.25 g/mol
Exact Mass250.11
IUPAC Namemethyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate
SMILESCOC(=O)COCCOCCOCC(=O)OC
InChIInChI=1S/C10H18O7/c1-13-9(11)7-16-5-3-15-4-6-17-8-10(12)14-2/h3-8H2,1-2H3
InChIKeyYKVQKHKEOTVVCM-UHFFFAOYSA-N
XLogP-0.62
TPSA80.29 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds10
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.25
LogP ≤ 5-0.62
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate?
The IUPAC name of methyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate (CID 4170388) is methyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate.
What is the SMILES notation for methyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate?
The canonical SMILES for methyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate is COC(=O)COCCOCCOCC(=O)OC.
What is the InChIKey of methyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate?
The InChIKey is YKVQKHKEOTVVCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O7/c1-13-9(11)7-16-5-3-15-4-6-17-8-10(12)14-2/h3-8H2,1-2H3.
What are the key properties of methyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate?
methyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate has a molecular weight of 250.25 g/mol, XLogP of -0.62, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-[2-(2-methoxy-2-oxoethoxy)ethoxy]ethoxy]acetate is sourced from PubChem (CID 4170388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).