methyl 2-(methoxymethoxy)acetate

C5H10O4 — CID 11018922

IUPACmethyl 2-(methoxymethoxy)acetate
SMILESCOCO[13CH2]C(=O)OC
InChIInChI=1S/C5H10O4/c1-7-4-9-3-5(6)8-2/h3-4H2,1-2H3/i3+1
InChIKeyMGFAPJQUDUFBHX-LBPDFUHNSA-N
MW135.12 g/mol
LogP-0.22
Rot. Bonds4

About methyl 2-(methoxymethoxy)acetate

methyl 2-(methoxymethoxy)acetate (PubChem CID 11018922) has the molecular formula C5H10O4 and a molecular weight of 135.12 g/mol. Its IUPAC name is methyl 2-(methoxymethoxy)acetate.

Molecular Properties

Compound Namemethyl 2-(methoxymethoxy)acetate
PubChem CID11018922
Molecular FormulaC5H10O4
Molecular Weight135.12 g/mol
Exact Mass135.06
IUPAC Namemethyl 2-(methoxymethoxy)acetate
SMILESCOCO[13CH2]C(=O)OC
InChIInChI=1S/C5H10O4/c1-7-4-9-3-5(6)8-2/h3-4H2,1-2H3/i3+1
InChIKeyMGFAPJQUDUFBHX-LBPDFUHNSA-N
XLogP-0.22
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500135.12
LogP ≤ 5-0.22
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze methyl 2-(methoxymethoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(methoxymethoxy)acetate?
The IUPAC name of methyl 2-(methoxymethoxy)acetate (CID 11018922) is methyl 2-(methoxymethoxy)acetate.
What is the SMILES notation for methyl 2-(methoxymethoxy)acetate?
The canonical SMILES for methyl 2-(methoxymethoxy)acetate is COCO[13CH2]C(=O)OC.
What is the InChIKey of methyl 2-(methoxymethoxy)acetate?
The InChIKey is MGFAPJQUDUFBHX-LBPDFUHNSA-N. The full InChI is InChI=1S/C5H10O4/c1-7-4-9-3-5(6)8-2/h3-4H2,1-2H3/i3+1.
What are the key properties of methyl 2-(methoxymethoxy)acetate?
methyl 2-(methoxymethoxy)acetate has a molecular weight of 135.12 g/mol, XLogP of -0.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(methoxymethoxy)acetate is sourced from PubChem (CID 11018922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).