C14H30N4O8 — CID 118569767
6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]hexane-1,2,3,4,5-pentol (PubChem CID 118569767) has the molecular formula C14H30N4O8 and a molecular weight of 382.41 g/mol. Its IUPAC name is 6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]hexane-1,2,3,4,5-pentol.
| Compound Name | 6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 118569767 |
| Molecular Formula | C14H30N4O8 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 6-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylamino]hexane-1,2,3,4,5-pentol |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNCC(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C14H30N4O8/c15-18-17-2-4-25-6-8-26-7-5-24-3-1-16-9-11(20)13(22)14(23)12(21)10-19/h11-14,16,19-23H,1-10H2 |
| InChIKey | SAJLPFFLGGJGMU-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 189.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|