C26H50N8O14 — CID 129158182
(2S,3R,4S,5R)-N,N'-bis[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2,3,4,5-tetrahydroxyhexanediamide (PubChem CID 129158182) has the molecular formula C26H50N8O14 and a molecular weight of 698.73 g/mol. Its IUPAC name is (2S,3R,4S,5R)-N,N'-bis[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2,3,4,5-tetrahydroxyhexanediamide.
| Compound Name | (2S,3R,4S,5R)-N,N'-bis[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2,3,4,5-tetrahydroxyhexanediamide |
|---|---|
| PubChem CID | 129158182 |
| Molecular Formula | C26H50N8O14 |
| Molecular Weight | 698.73 g/mol |
| Exact Mass | 698.34 |
| IUPAC Name | (2S,3R,4S,5R)-N,N'-bis[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethyl]-2,3,4,5-tetrahydroxyhexanediamide |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCNC(=O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)NCCOCCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C26H50N8O14/c27-33-31-3-7-43-11-15-47-19-17-45-13-9-41-5-1-29-25(39)23(37)21(35)22(36)24(38)26(40)30-2-6-42-10-14-46-18-20-48-16-12-44-8-4-32-34-28/h21-24,35-38H,1-20H2,(H,29,39)(H,30,40)/t21-,22+,23+,24- |
| InChIKey | XRSKDLOCHBUXMS-NVPYSNMXSA-N |
| XLogP | -2.58 |
| TPSA | 310.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.73 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|