C12H24N6O6 — CID 86718998
ethyl N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylcarbamoylamino]carbamate (PubChem CID 86718998) has the molecular formula C12H24N6O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is ethyl N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylcarbamoylamino]carbamate.
| Compound Name | ethyl N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylcarbamoylamino]carbamate |
|---|---|
| PubChem CID | 86718998 |
| Molecular Formula | C12H24N6O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | ethyl N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylcarbamoylamino]carbamate |
| SMILES | CCOC(=O)NNC(=O)NCCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C12H24N6O6/c1-2-24-12(20)17-16-11(19)14-3-5-21-7-9-23-10-8-22-6-4-15-18-13/h2-10H2,1H3,(H,17,20)(H2,14,16,19) |
| InChIKey | RTRFEKIHVSZURN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 155.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|