C9H19N5O5 — CID 118283829
2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl N-aminocarbamate (PubChem CID 118283829) has the molecular formula C9H19N5O5 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl N-aminocarbamate.
| Compound Name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl N-aminocarbamate |
|---|---|
| PubChem CID | 118283829 |
| Molecular Formula | C9H19N5O5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl N-aminocarbamate |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOC(=O)NN |
| InChI | InChI=1S/C9H19N5O5/c10-13-9(15)19-8-7-18-6-5-17-4-3-16-2-1-12-14-11/h1-8,10H2,(H,13,15) |
| InChIKey | PMYOWQVCRKOTPN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 140.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|