About azidomethyl N-aminocarbamate
azidomethyl N-aminocarbamate (PubChem CID 118181996) has the molecular formula C2H5N5O2
and a molecular weight of 131.10 g/mol. Its IUPAC name is azidomethyl N-aminocarbamate.
Molecular Properties
| Compound Name | azidomethyl N-aminocarbamate |
| PubChem CID | 118181996 |
| Molecular Formula | C2H5N5O2 |
| Molecular Weight | 131.10 g/mol |
| Exact Mass | 131.04 |
| IUPAC Name | azidomethyl N-aminocarbamate |
| SMILES | [N-]=[N+]=NCOC(=O)NN |
| InChI | InChI=1S/C2H5N5O2/c3-6-2(8)9-1-5-7-4/h1,3H2,(H,6,8) |
| InChIKey | ZRFNTKPHCYIEJR-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.10 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze azidomethyl N-aminocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azidomethyl N-aminocarbamate?
The IUPAC name of azidomethyl N-aminocarbamate (CID 118181996) is azidomethyl N-aminocarbamate.
What is the SMILES notation for azidomethyl N-aminocarbamate?
The canonical SMILES for azidomethyl N-aminocarbamate is [N-]=[N+]=NCOC(=O)NN.
What is the InChIKey of azidomethyl N-aminocarbamate?
The InChIKey is ZRFNTKPHCYIEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N5O2/c3-6-2(8)9-1-5-7-4/h1,3H2,(H,6,8).
What are the key properties of azidomethyl N-aminocarbamate?
azidomethyl N-aminocarbamate has a molecular weight of 131.10 g/mol, XLogP of -0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azidomethyl N-aminocarbamate is sourced from PubChem (CID 118181996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).