About azidomethyl 3-methylbutanoate
azidomethyl 3-methylbutanoate (PubChem CID 152605157) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is azidomethyl 3-methylbutanoate.
Molecular Properties
| Compound Name | azidomethyl 3-methylbutanoate |
| PubChem CID | 152605157 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | azidomethyl 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OCN=[N+]=[N-] |
| InChI | InChI=1S/C6H11N3O2/c1-5(2)3-6(10)11-4-8-9-7/h5H,3-4H2,1-2H3 |
| InChIKey | YYIOJOYHXYBRRV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azidomethyl 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azidomethyl 3-methylbutanoate?
The IUPAC name of azidomethyl 3-methylbutanoate (CID 152605157) is azidomethyl 3-methylbutanoate.
What is the SMILES notation for azidomethyl 3-methylbutanoate?
The canonical SMILES for azidomethyl 3-methylbutanoate is CC(C)CC(=O)OCN=[N+]=[N-].
What is the InChIKey of azidomethyl 3-methylbutanoate?
The InChIKey is YYIOJOYHXYBRRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O2/c1-5(2)3-6(10)11-4-8-9-7/h5H,3-4H2,1-2H3.
What are the key properties of azidomethyl 3-methylbutanoate?
azidomethyl 3-methylbutanoate has a molecular weight of 157.17 g/mol, XLogP of 1.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azidomethyl 3-methylbutanoate is sourced from PubChem (CID 152605157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).