About 3-methylbutaneperoxoic acid;hydrate
3-methylbutaneperoxoic acid;hydrate (PubChem CID 174845588) has the molecular formula C5H12O4
and a molecular weight of 136.15 g/mol. Its IUPAC name is 3-methylbutaneperoxoic acid;hydrate.
Molecular Properties
| Compound Name | 3-methylbutaneperoxoic acid;hydrate |
| PubChem CID | 174845588 |
| Molecular Formula | C5H12O4 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 3-methylbutaneperoxoic acid;hydrate |
| SMILES | CC(C)CC(=O)OO.O |
| InChI | InChI=1S/C5H10O3.H2O/c1-4(2)3-5(6)8-7;/h4,7H,3H2,1-2H3;1H2 |
| InChIKey | YVBVXBGLTBPZMH-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutaneperoxoic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutaneperoxoic acid;hydrate?
The IUPAC name of 3-methylbutaneperoxoic acid;hydrate (CID 174845588) is 3-methylbutaneperoxoic acid;hydrate.
What is the SMILES notation for 3-methylbutaneperoxoic acid;hydrate?
The canonical SMILES for 3-methylbutaneperoxoic acid;hydrate is CC(C)CC(=O)OO.O.
What is the InChIKey of 3-methylbutaneperoxoic acid;hydrate?
The InChIKey is YVBVXBGLTBPZMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.H2O/c1-4(2)3-5(6)8-7;/h4,7H,3H2,1-2H3;1H2.
What are the key properties of 3-methylbutaneperoxoic acid;hydrate?
3-methylbutaneperoxoic acid;hydrate has a molecular weight of 136.15 g/mol, XLogP of 0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutaneperoxoic acid;hydrate is sourced from PubChem (CID 174845588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).