About methanol;4-methylpentan-2-one;hydrate
methanol;4-methylpentan-2-one;hydrate (PubChem CID 87964162) has the molecular formula C7H18O3
and a molecular weight of 150.22 g/mol. Its IUPAC name is methanol;4-methylpentan-2-one;hydrate.
Molecular Properties
| Compound Name | methanol;4-methylpentan-2-one;hydrate |
| PubChem CID | 87964162 |
| Molecular Formula | C7H18O3 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.13 |
| IUPAC Name | methanol;4-methylpentan-2-one;hydrate |
| SMILES | CC(=O)CC(C)C.CO.O |
| InChI | InChI=1S/C6H12O.CH4O.H2O/c1-5(2)4-6(3)7;1-2;/h5H,4H2,1-3H3;2H,1H3;1H2 |
| InChIKey | VFTLJVXCIMNJAH-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanol;4-methylpentan-2-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;4-methylpentan-2-one;hydrate?
The IUPAC name of methanol;4-methylpentan-2-one;hydrate (CID 87964162) is methanol;4-methylpentan-2-one;hydrate.
What is the SMILES notation for methanol;4-methylpentan-2-one;hydrate?
The canonical SMILES for methanol;4-methylpentan-2-one;hydrate is CC(=O)CC(C)C.CO.O.
What is the InChIKey of methanol;4-methylpentan-2-one;hydrate?
The InChIKey is VFTLJVXCIMNJAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.CH4O.H2O/c1-5(2)4-6(3)7;1-2;/h5H,4H2,1-3H3;2H,1H3;1H2.
What are the key properties of methanol;4-methylpentan-2-one;hydrate?
methanol;4-methylpentan-2-one;hydrate has a molecular weight of 150.22 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;4-methylpentan-2-one;hydrate is sourced from PubChem (CID 87964162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).