About bis(cerium(3+));4-methylpentan-2-one;tris(oxygen(2-))
bis(cerium(3+));4-methylpentan-2-one;tris(oxygen(2-)) (PubChem CID 158984879) has the molecular formula C6H12Ce2O4
and a molecular weight of 428.39 g/mol. Its IUPAC name is bis(cerium(3+));4-methylpentan-2-one;tris(oxygen(2-)).
Molecular Properties
| Compound Name | bis(cerium(3+));4-methylpentan-2-one;tris(oxygen(2-)) |
| PubChem CID | 158984879 |
| Molecular Formula | C6H12Ce2O4 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 427.88 |
| IUPAC Name | bis(cerium(3+));4-methylpentan-2-one;tris(oxygen(2-)) |
| SMILES | CC(=O)CC(C)C.[Ce+3].[Ce+3].[O-2].[O-2].[O-2] |
| InChI | InChI=1S/C6H12O.2Ce.3O/c1-5(2)4-6(3)7;;;;;/h5H,4H2,1-3H3;;;;;/q;2*+3;3*-2 |
| InChIKey | FLKXZASNDBTCMA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 102.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bis(cerium(3+));4-methylpentan-2-one;tris(oxygen(2-)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cerium(3+));4-methylpentan-2-one;tris(oxygen(2-))?
The IUPAC name of bis(cerium(3+));4-methylpentan-2-one;tris(oxygen(2-)) (CID 158984879) is bis(cerium(3+));4-methylpentan-2-one;tris(oxygen(2-)).
What is the SMILES notation for bis(cerium(3+));4-methylpentan-2-one;tris(oxygen(2-))?
The canonical SMILES for bis(cerium(3+));4-methylpentan-2-one;tris(oxygen(2-)) is CC(=O)CC(C)C.[Ce+3].[Ce+3].[O-2].[O-2].[O-2].
What is the InChIKey of bis(cerium(3+));4-methylpentan-2-one;tris(oxygen(2-))?
The InChIKey is FLKXZASNDBTCMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.2Ce.3O/c1-5(2)4-6(3)7;;;;;/h5H,4H2,1-3H3;;;;;/q;2*+3;3*-2.
What are the key properties of bis(cerium(3+));4-methylpentan-2-one;tris(oxygen(2-))?
bis(cerium(3+));4-methylpentan-2-one;tris(oxygen(2-)) has a molecular weight of 428.39 g/mol, XLogP of 1.27, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cerium(3+));4-methylpentan-2-one;tris(oxygen(2-)) is sourced from PubChem (CID 158984879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).