About bis(1-hydroxypropan-2-one);4-methylpentan-2-one
bis(1-hydroxypropan-2-one);4-methylpentan-2-one (PubChem CID 88828646) has the molecular formula C12H24O5
and a molecular weight of 248.32 g/mol. Its IUPAC name is bis(1-hydroxypropan-2-one);4-methylpentan-2-one.
Molecular Properties
| Compound Name | bis(1-hydroxypropan-2-one);4-methylpentan-2-one |
| PubChem CID | 88828646 |
| Molecular Formula | C12H24O5 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | bis(1-hydroxypropan-2-one);4-methylpentan-2-one |
| SMILES | CC(=O)CC(C)C.CC(=O)CO.CC(=O)CO |
| InChI | InChI=1S/C6H12O.2C3H6O2/c1-5(2)4-6(3)7;2*1-3(5)2-4/h5H,4H2,1-3H3;2*4H,2H2,1H3 |
| InChIKey | CWCXFWRBSIEMBS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(1-hydroxypropan-2-one);4-methylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-hydroxypropan-2-one);4-methylpentan-2-one?
The IUPAC name of bis(1-hydroxypropan-2-one);4-methylpentan-2-one (CID 88828646) is bis(1-hydroxypropan-2-one);4-methylpentan-2-one.
What is the SMILES notation for bis(1-hydroxypropan-2-one);4-methylpentan-2-one?
The canonical SMILES for bis(1-hydroxypropan-2-one);4-methylpentan-2-one is CC(=O)CC(C)C.CC(=O)CO.CC(=O)CO.
What is the InChIKey of bis(1-hydroxypropan-2-one);4-methylpentan-2-one?
The InChIKey is CWCXFWRBSIEMBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.2C3H6O2/c1-5(2)4-6(3)7;2*1-3(5)2-4/h5H,4H2,1-3H3;2*4H,2H2,1H3.
What are the key properties of bis(1-hydroxypropan-2-one);4-methylpentan-2-one?
bis(1-hydroxypropan-2-one);4-methylpentan-2-one has a molecular weight of 248.32 g/mol, XLogP of 0.76, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-hydroxypropan-2-one);4-methylpentan-2-one is sourced from PubChem (CID 88828646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).