About 4-methylpentan-2-one;propane
4-methylpentan-2-one;propane (PubChem CID 22138072) has the molecular formula C9H20O
and a molecular weight of 144.26 g/mol. Its IUPAC name is 4-methylpentan-2-one;propane.
Molecular Properties
| Compound Name | 4-methylpentan-2-one;propane |
| PubChem CID | 22138072 |
| Molecular Formula | C9H20O |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.15 |
| IUPAC Name | 4-methylpentan-2-one;propane |
| SMILES | CC(=O)CC(C)C.CCC |
| InChI | InChI=1S/C6H12O.C3H8/c1-5(2)4-6(3)7;1-3-2/h5H,4H2,1-3H3;3H2,1-2H3 |
| InChIKey | ATJUWRQGIYKMIT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methylpentan-2-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentan-2-one;propane?
The IUPAC name of 4-methylpentan-2-one;propane (CID 22138072) is 4-methylpentan-2-one;propane.
What is the SMILES notation for 4-methylpentan-2-one;propane?
The canonical SMILES for 4-methylpentan-2-one;propane is CC(=O)CC(C)C.CCC.
What is the InChIKey of 4-methylpentan-2-one;propane?
The InChIKey is ATJUWRQGIYKMIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C3H8/c1-5(2)4-6(3)7;1-3-2/h5H,4H2,1-3H3;3H2,1-2H3.
What are the key properties of 4-methylpentan-2-one;propane?
4-methylpentan-2-one;propane has a molecular weight of 144.26 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentan-2-one;propane is sourced from PubChem (CID 22138072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).