C11H22O3 — CID 135383464
acetic acid;2,6-dimethylheptan-4-one (PubChem CID 135383464) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is acetic acid;2,6-dimethylheptan-4-one.
| Compound Name | acetic acid;2,6-dimethylheptan-4-one |
|---|---|
| PubChem CID | 135383464 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | acetic acid;2,6-dimethylheptan-4-one |
| SMILES | CC(=O)O.CC(C)CC(=O)CC(C)C |
| InChI | InChI=1S/C9H18O.C2H4O2/c1-7(2)5-9(10)6-8(3)4;1-2(3)4/h7-8H,5-6H2,1-4H3;1H3,(H,3,4) |
| InChIKey | GKRLCDTYBVSHOO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |