C13H26O2 — CID 23467085
2,6-dimethylheptan-4-one;oxolane (PubChem CID 23467085) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is 2,6-dimethylheptan-4-one;oxolane.
| Compound Name | 2,6-dimethylheptan-4-one;oxolane |
|---|---|
| PubChem CID | 23467085 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 2,6-dimethylheptan-4-one;oxolane |
| SMILES | C1CCOC1.CC(C)CC(=O)CC(C)C |
| InChI | InChI=1S/C9H18O.C4H8O/c1-7(2)5-9(10)6-8(3)4;1-2-4-5-3-1/h7-8H,5-6H2,1-4H3;1-4H2 |
| InChIKey | JCGUNDRGQSCMJZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |