C10H21ClO — CID 174654113
chloromethane;2,6-dimethylheptan-4-one (PubChem CID 174654113) has the molecular formula C10H21ClO and a molecular weight of 192.73 g/mol. Its IUPAC name is chloromethane;2,6-dimethylheptan-4-one.
| Compound Name | chloromethane;2,6-dimethylheptan-4-one |
|---|---|
| PubChem CID | 174654113 |
| Molecular Formula | C10H21ClO |
| Molecular Weight | 192.73 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | chloromethane;2,6-dimethylheptan-4-one |
| SMILES | CC(C)CC(=O)CC(C)C.CCl |
| InChI | InChI=1S/C9H18O.CH3Cl/c1-7(2)5-9(10)6-8(3)4;1-2/h7-8H,5-6H2,1-4H3;1H3 |
| InChIKey | RMNILRDIKGPZCD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.73 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|