C18H38O2 — CID 146305544
4,6-dimethylheptan-2-ol;2,6-dimethylheptan-4-one (PubChem CID 146305544) has the molecular formula C18H38O2 and a molecular weight of 286.50 g/mol. Its IUPAC name is 4,6-dimethylheptan-2-ol;2,6-dimethylheptan-4-one.
| Compound Name | 4,6-dimethylheptan-2-ol;2,6-dimethylheptan-4-one |
|---|---|
| PubChem CID | 146305544 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | 4,6-dimethylheptan-2-ol;2,6-dimethylheptan-4-one |
| SMILES | CC(C)CC(=O)CC(C)C.CC(C)CC(C)CC(C)O |
| InChI | InChI=1S/C9H20O.C9H18O/c1-7(2)5-8(3)6-9(4)10;1-7(2)5-9(10)6-8(3)4/h7-10H,5-6H2,1-4H3;7-8H,5-6H2,1-4H3 |
| InChIKey | LPXXUTTYRRZYBK-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |