C11H22O5 — CID 10609736
(2R,10R)-2,4,8,10-tetrahydroxyundecan-6-one (PubChem CID 10609736) has the molecular formula C11H22O5 and a molecular weight of 234.29 g/mol. Its IUPAC name is (2R,10R)-2,4,8,10-tetrahydroxyundecan-6-one.
| Compound Name | (2R,10R)-2,4,8,10-tetrahydroxyundecan-6-one |
|---|---|
| PubChem CID | 10609736 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (2R,10R)-2,4,8,10-tetrahydroxyundecan-6-one |
| SMILES | C[C@@H](O)CC(O)CC(=O)CC(O)C[C@@H](C)O |
| InChI | InChI=1S/C11H22O5/c1-7(12)3-9(14)5-11(16)6-10(15)4-8(2)13/h7-10,12-15H,3-6H2,1-2H3/t7-,8-,9?,10?/m1/s1 |
| InChIKey | ZANBMBUKSMFNEO-LGUIWLBCSA-N |
| XLogP | -0.40 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |