C20H38O8 — CID 157326986
tert-butyl (3R,5R)-3,5-dihydroxyhexanoate;tert-butyl 5-hydroxy-3-oxohexanoate (PubChem CID 157326986) has the molecular formula C20H38O8 and a molecular weight of 406.52 g/mol. Its IUPAC name is tert-butyl (3R,5R)-3,5-dihydroxyhexanoate;tert-butyl 5-hydroxy-3-oxohexanoate.
| Compound Name | tert-butyl (3R,5R)-3,5-dihydroxyhexanoate;tert-butyl 5-hydroxy-3-oxohexanoate |
|---|---|
| PubChem CID | 157326986 |
| Molecular Formula | C20H38O8 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | tert-butyl (3R,5R)-3,5-dihydroxyhexanoate;tert-butyl 5-hydroxy-3-oxohexanoate |
| SMILES | CC(O)CC(=O)CC(=O)OC(C)(C)C.C[C@@H](O)C[C@@H](O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H20O4.C10H18O4/c2*1-7(11)5-8(12)6-9(13)14-10(2,3)4/h7-8,11-12H,5-6H2,1-4H3;7,11H,5-6H2,1-4H3/t7-,8-;/m1./s1 |
| InChIKey | BEVPSJLLSKHVHI-SCLLHFNJSA-N |
| XLogP | 1.91 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|