C10H24O5Ti — CID 166004724
oxotitanium;bis(pentane-2,4-diol) (PubChem CID 166004724) has the molecular formula C10H24O5Ti and a molecular weight of 272.16 g/mol. Its IUPAC name is oxotitanium;bis(pentane-2,4-diol).
| Compound Name | oxotitanium;bis(pentane-2,4-diol) |
|---|---|
| PubChem CID | 166004724 |
| Molecular Formula | C10H24O5Ti |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | oxotitanium;bis(pentane-2,4-diol) |
| SMILES | CC(O)CC(C)O.CC(O)CC(C)O.O=[Ti] |
| InChI | InChI=1S/2C5H12O2.O.Ti/c2*1-4(6)3-5(2)7;;/h2*4-7H,3H2,1-2H3;; |
| InChIKey | LSHWZRCALWGXMM-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |