About CID 6395570
CID 6395570 (PubChem CID 6395570) has the molecular formula C5H14O3Tl2
and a molecular weight of 530.93 g/mol.
Molecular Properties
| Compound Name | CID 6395570 |
| PubChem CID | 6395570 |
| Molecular Formula | C5H14O3Tl2 |
| Molecular Weight | 530.93 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | — |
| SMILES | CC(O)CC(C)O.O.[Tl].[Tl] |
| InChI | InChI=1S/C5H12O2.H2O.2Tl/c1-4(6)3-5(2)7;;;/h4-7H,3H2,1-2H3;1H2;; |
| InChIKey | LOWGSAKRNIVBNR-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 530.93 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 6395570 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6395570?
The IUPAC name of CID 6395570 (CID 6395570) is not available.
What is the SMILES notation for CID 6395570?
The canonical SMILES for CID 6395570 is CC(O)CC(C)O.O.[Tl].[Tl].
What is the InChIKey of CID 6395570?
The InChIKey is LOWGSAKRNIVBNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2.H2O.2Tl/c1-4(6)3-5(2)7;;;/h4-7H,3H2,1-2H3;1H2;;.
What are the key properties of CID 6395570?
CID 6395570 has a molecular weight of 530.93 g/mol, XLogP of -1.45, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6395570 is sourced from PubChem (CID 6395570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).