About 4-methylpentan-2-ol;4-methylpentan-2-one;molecular hydrogen
4-methylpentan-2-ol;4-methylpentan-2-one;molecular hydrogen (PubChem CID 158587419) has the molecular formula C12H28O2
and a molecular weight of 204.35 g/mol. Its IUPAC name is 4-methylpentan-2-ol;4-methylpentan-2-one;molecular hydrogen.
Molecular Properties
| Compound Name | 4-methylpentan-2-ol;4-methylpentan-2-one;molecular hydrogen |
| PubChem CID | 158587419 |
| Molecular Formula | C12H28O2 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.21 |
| IUPAC Name | 4-methylpentan-2-ol;4-methylpentan-2-one;molecular hydrogen |
| SMILES | CC(=O)CC(C)C.CC(C)CC(C)O.[H][H] |
| InChI | InChI=1S/C6H14O.C6H12O.H2/c2*1-5(2)4-6(3)7;/h5-7H,4H2,1-3H3;5H,4H2,1-3H3;1H |
| InChIKey | HTZQXMWLIQMSDH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylpentan-2-ol;4-methylpentan-2-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentan-2-ol;4-methylpentan-2-one;molecular hydrogen?
The IUPAC name of 4-methylpentan-2-ol;4-methylpentan-2-one;molecular hydrogen (CID 158587419) is 4-methylpentan-2-ol;4-methylpentan-2-one;molecular hydrogen.
What is the SMILES notation for 4-methylpentan-2-ol;4-methylpentan-2-one;molecular hydrogen?
The canonical SMILES for 4-methylpentan-2-ol;4-methylpentan-2-one;molecular hydrogen is CC(=O)CC(C)C.CC(C)CC(C)O.[H][H].
What is the InChIKey of 4-methylpentan-2-ol;4-methylpentan-2-one;molecular hydrogen?
The InChIKey is HTZQXMWLIQMSDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C6H12O.H2/c2*1-5(2)4-6(3)7;/h5-7H,4H2,1-3H3;5H,4H2,1-3H3;1H.
What are the key properties of 4-methylpentan-2-ol;4-methylpentan-2-one;molecular hydrogen?
4-methylpentan-2-ol;4-methylpentan-2-one;molecular hydrogen has a molecular weight of 204.35 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentan-2-ol;4-methylpentan-2-one;molecular hydrogen is sourced from PubChem (CID 158587419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).