About carbon monoxide;4-hydroxypentan-2-one;rhodium
carbon monoxide;4-hydroxypentan-2-one;rhodium (PubChem CID 134992044) has the molecular formula C7H10O4Rh
and a molecular weight of 261.06 g/mol. Its IUPAC name is carbon monoxide;4-hydroxypentan-2-one;rhodium.
Molecular Properties
| Compound Name | carbon monoxide;4-hydroxypentan-2-one;rhodium |
| PubChem CID | 134992044 |
| Molecular Formula | C7H10O4Rh |
| Molecular Weight | 261.06 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | carbon monoxide;4-hydroxypentan-2-one;rhodium |
| SMILES | CC(=O)CC(C)O.[C-]#[O+].[C-]#[O+].[Rh] |
| InChI | InChI=1S/C5H10O2.2CO.Rh/c1-4(6)3-5(2)7;2*1-2;/h4,6H,3H2,1-2H3;;; |
| InChIKey | YQRRXTGQTXNYSJ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.06 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;4-hydroxypentan-2-one;rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;4-hydroxypentan-2-one;rhodium?
The IUPAC name of carbon monoxide;4-hydroxypentan-2-one;rhodium (CID 134992044) is carbon monoxide;4-hydroxypentan-2-one;rhodium.
What is the SMILES notation for carbon monoxide;4-hydroxypentan-2-one;rhodium?
The canonical SMILES for carbon monoxide;4-hydroxypentan-2-one;rhodium is CC(=O)CC(C)O.[C-]#[O+].[C-]#[O+].[Rh].
What is the InChIKey of carbon monoxide;4-hydroxypentan-2-one;rhodium?
The InChIKey is YQRRXTGQTXNYSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.2CO.Rh/c1-4(6)3-5(2)7;2*1-2;/h4,6H,3H2,1-2H3;;;.
What are the key properties of carbon monoxide;4-hydroxypentan-2-one;rhodium?
carbon monoxide;4-hydroxypentan-2-one;rhodium has a molecular weight of 261.06 g/mol, XLogP of 0.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;4-hydroxypentan-2-one;rhodium is sourced from PubChem (CID 134992044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).