About 3-amino-4-hydroxypentan-2-one;4-hydroxypentan-2-one
3-amino-4-hydroxypentan-2-one;4-hydroxypentan-2-one (PubChem CID 159964443) has the molecular formula C10H21NO4
and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-amino-4-hydroxypentan-2-one;4-hydroxypentan-2-one.
Molecular Properties
| Compound Name | 3-amino-4-hydroxypentan-2-one;4-hydroxypentan-2-one |
| PubChem CID | 159964443 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 3-amino-4-hydroxypentan-2-one;4-hydroxypentan-2-one |
| SMILES | CC(=O)C(N)C(C)O.CC(=O)CC(C)O |
| InChI | InChI=1S/C5H11NO2.C5H10O2/c1-3(7)5(6)4(2)8;1-4(6)3-5(2)7/h3,5,7H,6H2,1-2H3;4,6H,3H2,1-2H3 |
| InChIKey | ODTCTOVQGCICSV-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-4-hydroxypentan-2-one;4-hydroxypentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-hydroxypentan-2-one;4-hydroxypentan-2-one?
The IUPAC name of 3-amino-4-hydroxypentan-2-one;4-hydroxypentan-2-one (CID 159964443) is 3-amino-4-hydroxypentan-2-one;4-hydroxypentan-2-one.
What is the SMILES notation for 3-amino-4-hydroxypentan-2-one;4-hydroxypentan-2-one?
The canonical SMILES for 3-amino-4-hydroxypentan-2-one;4-hydroxypentan-2-one is CC(=O)C(N)C(C)O.CC(=O)CC(C)O.
What is the InChIKey of 3-amino-4-hydroxypentan-2-one;4-hydroxypentan-2-one?
The InChIKey is ODTCTOVQGCICSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.C5H10O2/c1-3(7)5(6)4(2)8;1-4(6)3-5(2)7/h3,5,7H,6H2,1-2H3;4,6H,3H2,1-2H3.
What are the key properties of 3-amino-4-hydroxypentan-2-one;4-hydroxypentan-2-one?
3-amino-4-hydroxypentan-2-one;4-hydroxypentan-2-one has a molecular weight of 219.28 g/mol, XLogP of -0.37, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-hydroxypentan-2-one;4-hydroxypentan-2-one is sourced from PubChem (CID 159964443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).