About 4-methylpentan-2-one;methylsulfinylmethane
4-methylpentan-2-one;methylsulfinylmethane (PubChem CID 87495455) has the molecular formula C8H18O2S
and a molecular weight of 178.30 g/mol. Its IUPAC name is 4-methylpentan-2-one;methylsulfinylmethane.
Molecular Properties
| Compound Name | 4-methylpentan-2-one;methylsulfinylmethane |
| PubChem CID | 87495455 |
| Molecular Formula | C8H18O2S |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 4-methylpentan-2-one;methylsulfinylmethane |
| SMILES | CC(=O)CC(C)C.CS(C)=O |
| InChI | InChI=1S/C6H12O.C2H6OS/c1-5(2)4-6(3)7;1-4(2)3/h5H,4H2,1-3H3;1-2H3 |
| InChIKey | YQNUSJXHKYBLST-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylpentan-2-one;methylsulfinylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentan-2-one;methylsulfinylmethane?
The IUPAC name of 4-methylpentan-2-one;methylsulfinylmethane (CID 87495455) is 4-methylpentan-2-one;methylsulfinylmethane.
What is the SMILES notation for 4-methylpentan-2-one;methylsulfinylmethane?
The canonical SMILES for 4-methylpentan-2-one;methylsulfinylmethane is CC(=O)CC(C)C.CS(C)=O.
What is the InChIKey of 4-methylpentan-2-one;methylsulfinylmethane?
The InChIKey is YQNUSJXHKYBLST-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C2H6OS/c1-5(2)4-6(3)7;1-4(2)3/h5H,4H2,1-3H3;1-2H3.
What are the key properties of 4-methylpentan-2-one;methylsulfinylmethane?
4-methylpentan-2-one;methylsulfinylmethane has a molecular weight of 178.30 g/mol, XLogP of 1.62, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentan-2-one;methylsulfinylmethane is sourced from PubChem (CID 87495455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).