C17H34O2 — CID 159810749
4-methylpentan-2-one;2,3,5,6-tetramethylheptan-4-one (PubChem CID 159810749) has the molecular formula C17H34O2 and a molecular weight of 270.46 g/mol. Its IUPAC name is 4-methylpentan-2-one;2,3,5,6-tetramethylheptan-4-one.
| Compound Name | 4-methylpentan-2-one;2,3,5,6-tetramethylheptan-4-one |
|---|---|
| PubChem CID | 159810749 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | 4-methylpentan-2-one;2,3,5,6-tetramethylheptan-4-one |
| SMILES | CC(=O)CC(C)C.CC(C)C(C)C(=O)C(C)C(C)C |
| InChI | InChI=1S/C11H22O.C6H12O/c1-7(2)9(5)11(12)10(6)8(3)4;1-5(2)4-6(3)7/h7-10H,1-6H3;5H,4H2,1-3H3 |
| InChIKey | NKZJUSUCLNYMPO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |