About butan-2-one;hexan-2-one;4-methylpentan-2-one;propan-2-one
butan-2-one;hexan-2-one;4-methylpentan-2-one;propan-2-one (PubChem CID 161207963) has the molecular formula C19H38O4
and a molecular weight of 330.51 g/mol. Its IUPAC name is butan-2-one;hexan-2-one;4-methylpentan-2-one;propan-2-one.
Molecular Properties
| Compound Name | butan-2-one;hexan-2-one;4-methylpentan-2-one;propan-2-one |
| PubChem CID | 161207963 |
| Molecular Formula | C19H38O4 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.28 |
| IUPAC Name | butan-2-one;hexan-2-one;4-methylpentan-2-one;propan-2-one |
| SMILES | CC(=O)CC(C)C.CC(C)=O.CCC(C)=O.CCCCC(C)=O |
| InChI | InChI=1S/2C6H12O.C4H8O.C3H6O/c1-5(2)4-6(3)7;1-3-4-5-6(2)7;1-3-4(2)5;1-3(2)4/h5H,4H2,1-3H3;3-5H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | UVVXJJOYDWCIII-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze butan-2-one;hexan-2-one;4-methylpentan-2-one;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;hexan-2-one;4-methylpentan-2-one;propan-2-one?
The IUPAC name of butan-2-one;hexan-2-one;4-methylpentan-2-one;propan-2-one (CID 161207963) is butan-2-one;hexan-2-one;4-methylpentan-2-one;propan-2-one.
What is the SMILES notation for butan-2-one;hexan-2-one;4-methylpentan-2-one;propan-2-one?
The canonical SMILES for butan-2-one;hexan-2-one;4-methylpentan-2-one;propan-2-one is CC(=O)CC(C)C.CC(C)=O.CCC(C)=O.CCCCC(C)=O.
What is the InChIKey of butan-2-one;hexan-2-one;4-methylpentan-2-one;propan-2-one?
The InChIKey is UVVXJJOYDWCIII-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H12O.C4H8O.C3H6O/c1-5(2)4-6(3)7;1-3-4-5-6(2)7;1-3-4(2)5;1-3(2)4/h5H,4H2,1-3H3;3-5H2,1-2H3;3H2,1-2H3;1-2H3.
What are the key properties of butan-2-one;hexan-2-one;4-methylpentan-2-one;propan-2-one?
butan-2-one;hexan-2-one;4-methylpentan-2-one;propan-2-one has a molecular weight of 330.51 g/mol, XLogP of 4.97, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;hexan-2-one;4-methylpentan-2-one;propan-2-one is sourced from PubChem (CID 161207963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).