About acetic acid;(2R)-hexan-2-ol;hexan-2-one
acetic acid;(2R)-hexan-2-ol;hexan-2-one (PubChem CID 118050364) has the molecular formula C14H30O4
and a molecular weight of 262.39 g/mol. Its IUPAC name is acetic acid;(2R)-hexan-2-ol;hexan-2-one.
Molecular Properties
| Compound Name | acetic acid;(2R)-hexan-2-ol;hexan-2-one |
| PubChem CID | 118050364 |
| Molecular Formula | C14H30O4 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | acetic acid;(2R)-hexan-2-ol;hexan-2-one |
| SMILES | CC(=O)O.CCCCC(C)=O.CCCC[C@@H](C)O |
| InChI | InChI=1S/C6H14O.C6H12O.C2H4O2/c2*1-3-4-5-6(2)7;1-2(3)4/h6-7H,3-5H2,1-2H3;3-5H2,1-2H3;1H3,(H,3,4)/t6-;;/m1../s1 |
| InChIKey | DPRRZNTVQGUXKL-QYCVXMPOSA-N |
| XLogP | 3.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;(2R)-hexan-2-ol;hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(2R)-hexan-2-ol;hexan-2-one?
The IUPAC name of acetic acid;(2R)-hexan-2-ol;hexan-2-one (CID 118050364) is acetic acid;(2R)-hexan-2-ol;hexan-2-one.
What is the SMILES notation for acetic acid;(2R)-hexan-2-ol;hexan-2-one?
The canonical SMILES for acetic acid;(2R)-hexan-2-ol;hexan-2-one is CC(=O)O.CCCCC(C)=O.CCCC[C@@H](C)O.
What is the InChIKey of acetic acid;(2R)-hexan-2-ol;hexan-2-one?
The InChIKey is DPRRZNTVQGUXKL-QYCVXMPOSA-N. The full InChI is InChI=1S/C6H14O.C6H12O.C2H4O2/c2*1-3-4-5-6(2)7;1-2(3)4/h6-7H,3-5H2,1-2H3;3-5H2,1-2H3;1H3,(H,3,4)/t6-;;/m1../s1.
What are the key properties of acetic acid;(2R)-hexan-2-ol;hexan-2-one?
acetic acid;(2R)-hexan-2-ol;hexan-2-one has a molecular weight of 262.39 g/mol, XLogP of 3.41, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(2R)-hexan-2-ol;hexan-2-one is sourced from PubChem (CID 118050364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).