C12H24O2 — CID 87718368
3,3-dimethylbutan-2-one;4-methylpentan-2-one (PubChem CID 87718368) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-one;4-methylpentan-2-one.
| Compound Name | 3,3-dimethylbutan-2-one;4-methylpentan-2-one |
|---|---|
| PubChem CID | 87718368 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 3,3-dimethylbutan-2-one;4-methylpentan-2-one |
| SMILES | CC(=O)C(C)(C)C.CC(=O)CC(C)C |
| InChI | InChI=1S/2C6H12O/c1-5(7)6(2,3)4;1-5(2)4-6(3)7/h1-4H3;5H,4H2,1-3H3 |
| InChIKey | ITHNYSBKRXRAJC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |