About 2-aminoethanol;4-methylpentan-2-one
2-aminoethanol;4-methylpentan-2-one (PubChem CID 157060535) has the molecular formula C8H19NO2
and a molecular weight of 161.24 g/mol. Its IUPAC name is 2-aminoethanol;4-methylpentan-2-one.
Molecular Properties
| Compound Name | 2-aminoethanol;4-methylpentan-2-one |
| PubChem CID | 157060535 |
| Molecular Formula | C8H19NO2 |
| Molecular Weight | 161.24 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | 2-aminoethanol;4-methylpentan-2-one |
| SMILES | CC(=O)CC(C)C.NCCO |
| InChI | InChI=1S/C6H12O.C2H7NO/c1-5(2)4-6(3)7;3-1-2-4/h5H,4H2,1-3H3;4H,1-3H2 |
| InChIKey | ABGZOMLVZZBKSJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminoethanol;4-methylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;4-methylpentan-2-one?
The IUPAC name of 2-aminoethanol;4-methylpentan-2-one (CID 157060535) is 2-aminoethanol;4-methylpentan-2-one.
What is the SMILES notation for 2-aminoethanol;4-methylpentan-2-one?
The canonical SMILES for 2-aminoethanol;4-methylpentan-2-one is CC(=O)CC(C)C.NCCO.
What is the InChIKey of 2-aminoethanol;4-methylpentan-2-one?
The InChIKey is ABGZOMLVZZBKSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C2H7NO/c1-5(2)4-6(3)7;3-1-2-4/h5H,4H2,1-3H3;4H,1-3H2.
What are the key properties of 2-aminoethanol;4-methylpentan-2-one?
2-aminoethanol;4-methylpentan-2-one has a molecular weight of 161.24 g/mol, XLogP of 0.56, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;4-methylpentan-2-one is sourced from PubChem (CID 157060535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).