About tris(2-aminoethanol);propan-2-ol;titanium
tris(2-aminoethanol);propan-2-ol;titanium (PubChem CID 173415669) has the molecular formula C9H29N3O4Ti
and a molecular weight of 291.22 g/mol. Its IUPAC name is tris(2-aminoethanol);propan-2-ol;titanium.
Molecular Properties
| Compound Name | tris(2-aminoethanol);propan-2-ol;titanium |
| PubChem CID | 173415669 |
| Molecular Formula | C9H29N3O4Ti |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | tris(2-aminoethanol);propan-2-ol;titanium |
| SMILES | CC(C)O.NCCO.NCCO.NCCO.[Ti] |
| InChI | InChI=1S/C3H8O.3C2H7NO.Ti/c1-3(2)4;3*3-1-2-4;/h3-4H,1-2H3;3*4H,1-3H2; |
| InChIKey | HEJLXMBEOPFACT-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 158.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tris(2-aminoethanol);propan-2-ol;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2-aminoethanol);propan-2-ol;titanium?
The IUPAC name of tris(2-aminoethanol);propan-2-ol;titanium (CID 173415669) is tris(2-aminoethanol);propan-2-ol;titanium.
What is the SMILES notation for tris(2-aminoethanol);propan-2-ol;titanium?
The canonical SMILES for tris(2-aminoethanol);propan-2-ol;titanium is CC(C)O.NCCO.NCCO.NCCO.[Ti].
What is the InChIKey of tris(2-aminoethanol);propan-2-ol;titanium?
The InChIKey is HEJLXMBEOPFACT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.3C2H7NO.Ti/c1-3(2)4;3*3-1-2-4;/h3-4H,1-2H3;3*4H,1-3H2;.
What are the key properties of tris(2-aminoethanol);propan-2-ol;titanium?
tris(2-aminoethanol);propan-2-ol;titanium has a molecular weight of 291.22 g/mol, XLogP of -2.80, 3 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2-aminoethanol);propan-2-ol;titanium is sourced from PubChem (CID 173415669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).