About 2-aminoethanol;1-[bis(1-hydroxyethyl)amino]ethanol
2-aminoethanol;1-[bis(1-hydroxyethyl)amino]ethanol (PubChem CID 173459729) has the molecular formula C8H22N2O4
and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-aminoethanol;1-[bis(1-hydroxyethyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-aminoethanol;1-[bis(1-hydroxyethyl)amino]ethanol |
| PubChem CID | 173459729 |
| Molecular Formula | C8H22N2O4 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 2-aminoethanol;1-[bis(1-hydroxyethyl)amino]ethanol |
| SMILES | CC(O)N(C(C)O)C(C)O.NCCO |
| InChI | InChI=1S/C6H15NO3.C2H7NO/c1-4(8)7(5(2)9)6(3)10;3-1-2-4/h4-6,8-10H,1-3H3;4H,1-3H2 |
| InChIKey | AOVVRGQIYQZRHA-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanol;1-[bis(1-hydroxyethyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;1-[bis(1-hydroxyethyl)amino]ethanol?
The IUPAC name of 2-aminoethanol;1-[bis(1-hydroxyethyl)amino]ethanol (CID 173459729) is 2-aminoethanol;1-[bis(1-hydroxyethyl)amino]ethanol.
What is the SMILES notation for 2-aminoethanol;1-[bis(1-hydroxyethyl)amino]ethanol?
The canonical SMILES for 2-aminoethanol;1-[bis(1-hydroxyethyl)amino]ethanol is CC(O)N(C(C)O)C(C)O.NCCO.
What is the InChIKey of 2-aminoethanol;1-[bis(1-hydroxyethyl)amino]ethanol?
The InChIKey is AOVVRGQIYQZRHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.C2H7NO/c1-4(8)7(5(2)9)6(3)10;3-1-2-4/h4-6,8-10H,1-3H3;4H,1-3H2.
What are the key properties of 2-aminoethanol;1-[bis(1-hydroxyethyl)amino]ethanol?
2-aminoethanol;1-[bis(1-hydroxyethyl)amino]ethanol has a molecular weight of 210.27 g/mol, XLogP of -1.76, 4 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;1-[bis(1-hydroxyethyl)amino]ethanol is sourced from PubChem (CID 173459729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).