About 2-aminoethanol;N,N-dimethylmethanamine;dihydrate
2-aminoethanol;N,N-dimethylmethanamine;dihydrate (PubChem CID 174282779) has the molecular formula C5H20N2O3
and a molecular weight of 156.23 g/mol. Its IUPAC name is 2-aminoethanol;N,N-dimethylmethanamine;dihydrate.
Molecular Properties
| Compound Name | 2-aminoethanol;N,N-dimethylmethanamine;dihydrate |
| PubChem CID | 174282779 |
| Molecular Formula | C5H20N2O3 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | 2-aminoethanol;N,N-dimethylmethanamine;dihydrate |
| SMILES | CN(C)C.NCCO.O.O |
| InChI | InChI=1S/C3H9N.C2H7NO.2H2O/c1-4(2)3;3-1-2-4;;/h1-3H3;4H,1-3H2;2*1H2 |
| InChIKey | YNYNWYITBQVUSQ-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminoethanol;N,N-dimethylmethanamine;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;N,N-dimethylmethanamine;dihydrate?
The IUPAC name of 2-aminoethanol;N,N-dimethylmethanamine;dihydrate (CID 174282779) is 2-aminoethanol;N,N-dimethylmethanamine;dihydrate.
What is the SMILES notation for 2-aminoethanol;N,N-dimethylmethanamine;dihydrate?
The canonical SMILES for 2-aminoethanol;N,N-dimethylmethanamine;dihydrate is CN(C)C.NCCO.O.O.
What is the InChIKey of 2-aminoethanol;N,N-dimethylmethanamine;dihydrate?
The InChIKey is YNYNWYITBQVUSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2H7NO.2H2O/c1-4(2)3;3-1-2-4;;/h1-3H3;4H,1-3H2;2*1H2.
What are the key properties of 2-aminoethanol;N,N-dimethylmethanamine;dihydrate?
2-aminoethanol;N,N-dimethylmethanamine;dihydrate has a molecular weight of 156.23 g/mol, XLogP of -2.53, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;N,N-dimethylmethanamine;dihydrate is sourced from PubChem (CID 174282779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).