About 2-aminoethanol;N,N-dimethylmethanamine;hydrochloride
2-aminoethanol;N,N-dimethylmethanamine;hydrochloride (PubChem CID 174601268) has the molecular formula C5H17ClN2O
and a molecular weight of 156.66 g/mol. Its IUPAC name is 2-aminoethanol;N,N-dimethylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-aminoethanol;N,N-dimethylmethanamine;hydrochloride |
| PubChem CID | 174601268 |
| Molecular Formula | C5H17ClN2O |
| Molecular Weight | 156.66 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 2-aminoethanol;N,N-dimethylmethanamine;hydrochloride |
| SMILES | CN(C)C.Cl.NCCO |
| InChI | InChI=1S/C3H9N.C2H7NO.ClH/c1-4(2)3;3-1-2-4;/h1-3H3;4H,1-3H2;1H |
| InChIKey | VQZVPGRSKLCARA-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.66 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminoethanol;N,N-dimethylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;N,N-dimethylmethanamine;hydrochloride?
The IUPAC name of 2-aminoethanol;N,N-dimethylmethanamine;hydrochloride (CID 174601268) is 2-aminoethanol;N,N-dimethylmethanamine;hydrochloride.
What is the SMILES notation for 2-aminoethanol;N,N-dimethylmethanamine;hydrochloride?
The canonical SMILES for 2-aminoethanol;N,N-dimethylmethanamine;hydrochloride is CN(C)C.Cl.NCCO.
What is the InChIKey of 2-aminoethanol;N,N-dimethylmethanamine;hydrochloride?
The InChIKey is VQZVPGRSKLCARA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2H7NO.ClH/c1-4(2)3;3-1-2-4;/h1-3H3;4H,1-3H2;1H.
What are the key properties of 2-aminoethanol;N,N-dimethylmethanamine;hydrochloride?
2-aminoethanol;N,N-dimethylmethanamine;hydrochloride has a molecular weight of 156.66 g/mol, XLogP of -0.46, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;N,N-dimethylmethanamine;hydrochloride is sourced from PubChem (CID 174601268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).