About 2-aminoethanol;2-hydroxypropanal
2-aminoethanol;2-hydroxypropanal (PubChem CID 88787093) has the molecular formula C5H13NO3
and a molecular weight of 135.16 g/mol. Its IUPAC name is 2-aminoethanol;2-hydroxypropanal.
Molecular Properties
| Compound Name | 2-aminoethanol;2-hydroxypropanal |
| PubChem CID | 88787093 |
| Molecular Formula | C5H13NO3 |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 2-aminoethanol;2-hydroxypropanal |
| SMILES | CC(O)C=O.NCCO |
| InChI | InChI=1S/C3H6O2.C2H7NO/c1-3(5)2-4;3-1-2-4/h2-3,5H,1H3;4H,1-3H2 |
| InChIKey | LCTJAWSCVFPABI-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanol;2-hydroxypropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;2-hydroxypropanal?
The IUPAC name of 2-aminoethanol;2-hydroxypropanal (CID 88787093) is 2-aminoethanol;2-hydroxypropanal.
What is the SMILES notation for 2-aminoethanol;2-hydroxypropanal?
The canonical SMILES for 2-aminoethanol;2-hydroxypropanal is CC(O)C=O.NCCO.
What is the InChIKey of 2-aminoethanol;2-hydroxypropanal?
The InChIKey is LCTJAWSCVFPABI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.C2H7NO/c1-3(5)2-4;3-1-2-4/h2-3,5H,1H3;4H,1-3H2.
What are the key properties of 2-aminoethanol;2-hydroxypropanal?
2-aminoethanol;2-hydroxypropanal has a molecular weight of 135.16 g/mol, XLogP of -1.50, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;2-hydroxypropanal is sourced from PubChem (CID 88787093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).