C3H6O2 — CID 169442815
2-hydroxy(1,2,3-13C3)propanal (PubChem CID 169442815) has the molecular formula C3H6O2 and a molecular weight of 77.06 g/mol. Its IUPAC name is 2-hydroxy(1,2,3-13C3)propanal.
| Compound Name | 2-hydroxy(1,2,3-13C3)propanal |
|---|---|
| PubChem CID | 169442815 |
| Molecular Formula | C3H6O2 |
| Molecular Weight | 77.06 g/mol |
| Exact Mass | 77.05 |
| IUPAC Name | 2-hydroxy(1,2,3-13C3)propanal |
| SMILES | [13CH3][13CH](O)[13CH]=O |
| InChI | InChI=1S/C3H6O2/c1-3(5)2-4/h2-3,5H,1H3/i1+1,2+1,3+1 |
| InChIKey | BSABBBMNWQWLLU-VMIGTVKRSA-N |
| XLogP | -0.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 77.06 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|