C5H10O2Y — CID 59809466
(2S,3S)-3-hydroxy-2-methylbutanal;yttrium (PubChem CID 59809466) has the molecular formula C5H10O2Y and a molecular weight of 191.04 g/mol. Its IUPAC name is (2S,3S)-3-hydroxy-2-methylbutanal;yttrium.
| Compound Name | (2S,3S)-3-hydroxy-2-methylbutanal;yttrium |
|---|---|
| PubChem CID | 59809466 |
| Molecular Formula | C5H10O2Y |
| Molecular Weight | 191.04 g/mol |
| Exact Mass | 190.97 |
| IUPAC Name | (2S,3S)-3-hydroxy-2-methylbutanal;yttrium |
| SMILES | C[C@H](O)[C@H](C)C=O.[Y] |
| InChI | InChI=1S/C5H10O2.Y/c1-4(3-6)5(2)7;/h3-5,7H,1-2H3;/t4-,5+;/m1./s1 |
| InChIKey | IHPGWHRRQVSHGH-JBUOLDKXSA-N |
| XLogP | 0.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.04 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|