About hydrogen peroxide;2-methylpropanal
hydrogen peroxide;2-methylpropanal (PubChem CID 174448714) has the molecular formula C4H10O3
and a molecular weight of 106.12 g/mol. Its IUPAC name is hydrogen peroxide;2-methylpropanal.
Molecular Properties
| Compound Name | hydrogen peroxide;2-methylpropanal |
| PubChem CID | 174448714 |
| Molecular Formula | C4H10O3 |
| Molecular Weight | 106.12 g/mol |
| Exact Mass | 106.06 |
| IUPAC Name | hydrogen peroxide;2-methylpropanal |
| SMILES | CC(C)C=O.OO |
| InChI | InChI=1S/C4H8O.H2O2/c1-4(2)3-5;1-2/h3-4H,1-2H3;1-2H |
| InChIKey | BJJSOCILIWHZKD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.12 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hydrogen peroxide;2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen peroxide;2-methylpropanal?
The IUPAC name of hydrogen peroxide;2-methylpropanal (CID 174448714) is hydrogen peroxide;2-methylpropanal.
What is the SMILES notation for hydrogen peroxide;2-methylpropanal?
The canonical SMILES for hydrogen peroxide;2-methylpropanal is CC(C)C=O.OO.
What is the InChIKey of hydrogen peroxide;2-methylpropanal?
The InChIKey is BJJSOCILIWHZKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.H2O2/c1-4(2)3-5;1-2/h3-4H,1-2H3;1-2H.
What are the key properties of hydrogen peroxide;2-methylpropanal?
hydrogen peroxide;2-methylpropanal has a molecular weight of 106.12 g/mol, XLogP of 0.86, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;2-methylpropanal is sourced from PubChem (CID 174448714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).