About ethane;1-(methylamino)propan-2-one;2-methylpropanal
ethane;1-(methylamino)propan-2-one;2-methylpropanal (PubChem CID 170710537) has the molecular formula C10H23NO2
and a molecular weight of 189.30 g/mol. Its IUPAC name is ethane;1-(methylamino)propan-2-one;2-methylpropanal.
Molecular Properties
| Compound Name | ethane;1-(methylamino)propan-2-one;2-methylpropanal |
| PubChem CID | 170710537 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | ethane;1-(methylamino)propan-2-one;2-methylpropanal |
| SMILES | CC.CC(C)C=O.CNCC(C)=O |
| InChI | InChI=1S/C4H9NO.C4H8O.C2H6/c1-4(6)3-5-2;1-4(2)3-5;1-2/h5H,3H2,1-2H3;3-4H,1-2H3;1-2H3 |
| InChIKey | FNUQTFKBBVTJAE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(methylamino)propan-2-one;2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(methylamino)propan-2-one;2-methylpropanal?
The IUPAC name of ethane;1-(methylamino)propan-2-one;2-methylpropanal (CID 170710537) is ethane;1-(methylamino)propan-2-one;2-methylpropanal.
What is the SMILES notation for ethane;1-(methylamino)propan-2-one;2-methylpropanal?
The canonical SMILES for ethane;1-(methylamino)propan-2-one;2-methylpropanal is CC.CC(C)C=O.CNCC(C)=O.
What is the InChIKey of ethane;1-(methylamino)propan-2-one;2-methylpropanal?
The InChIKey is FNUQTFKBBVTJAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C4H8O.C2H6/c1-4(6)3-5-2;1-4(2)3-5;1-2/h5H,3H2,1-2H3;3-4H,1-2H3;1-2H3.
What are the key properties of ethane;1-(methylamino)propan-2-one;2-methylpropanal?
ethane;1-(methylamino)propan-2-one;2-methylpropanal has a molecular weight of 189.30 g/mol, XLogP of 1.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(methylamino)propan-2-one;2-methylpropanal is sourced from PubChem (CID 170710537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).