About ethane;2-(methylamino)acetic acid;methyl formate
ethane;2-(methylamino)acetic acid;methyl formate (PubChem CID 144537769) has the molecular formula C7H17NO4
and a molecular weight of 179.22 g/mol. Its IUPAC name is ethane;2-(methylamino)acetic acid;methyl formate.
Molecular Properties
| Compound Name | ethane;2-(methylamino)acetic acid;methyl formate |
| PubChem CID | 144537769 |
| Molecular Formula | C7H17NO4 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | ethane;2-(methylamino)acetic acid;methyl formate |
| SMILES | CC.CNCC(=O)O.COC=O |
| InChI | InChI=1S/C3H7NO2.C2H4O2.C2H6/c1-4-2-3(5)6;1-4-2-3;1-2/h4H,2H2,1H3,(H,5,6);2H,1H3;1-2H3 |
| InChIKey | SVYGZNSPSYIWLM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(methylamino)acetic acid;methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(methylamino)acetic acid;methyl formate?
The IUPAC name of ethane;2-(methylamino)acetic acid;methyl formate (CID 144537769) is ethane;2-(methylamino)acetic acid;methyl formate.
What is the SMILES notation for ethane;2-(methylamino)acetic acid;methyl formate?
The canonical SMILES for ethane;2-(methylamino)acetic acid;methyl formate is CC.CNCC(=O)O.COC=O.
What is the InChIKey of ethane;2-(methylamino)acetic acid;methyl formate?
The InChIKey is SVYGZNSPSYIWLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.C2H4O2.C2H6/c1-4-2-3(5)6;1-4-2-3;1-2/h4H,2H2,1H3,(H,5,6);2H,1H3;1-2H3.
What are the key properties of ethane;2-(methylamino)acetic acid;methyl formate?
ethane;2-(methylamino)acetic acid;methyl formate has a molecular weight of 179.22 g/mol, XLogP of 0.11, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(methylamino)acetic acid;methyl formate is sourced from PubChem (CID 144537769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).