About 2-(methylamino)acetic acid;2-methylphenol
2-(methylamino)acetic acid;2-methylphenol (PubChem CID 67651337) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-(methylamino)acetic acid;2-methylphenol.
Molecular Properties
| Compound Name | 2-(methylamino)acetic acid;2-methylphenol |
| PubChem CID | 67651337 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-(methylamino)acetic acid;2-methylphenol |
| SMILES | CNCC(=O)O.Cc1ccccc1O |
| InChI | InChI=1S/C7H8O.C3H7NO2/c1-6-4-2-3-5-7(6)8;1-4-2-3(5)6/h2-5,8H,1H3;4H,2H2,1H3,(H,5,6) |
| InChIKey | UNSLTNDFKHRGJV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(methylamino)acetic acid;2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)acetic acid;2-methylphenol?
The IUPAC name of 2-(methylamino)acetic acid;2-methylphenol (CID 67651337) is 2-(methylamino)acetic acid;2-methylphenol.
What is the SMILES notation for 2-(methylamino)acetic acid;2-methylphenol?
The canonical SMILES for 2-(methylamino)acetic acid;2-methylphenol is CNCC(=O)O.Cc1ccccc1O.
What is the InChIKey of 2-(methylamino)acetic acid;2-methylphenol?
The InChIKey is UNSLTNDFKHRGJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C3H7NO2/c1-6-4-2-3-5-7(6)8;1-4-2-3(5)6/h2-5,8H,1H3;4H,2H2,1H3,(H,5,6).
What are the key properties of 2-(methylamino)acetic acid;2-methylphenol?
2-(methylamino)acetic acid;2-methylphenol has a molecular weight of 197.23 g/mol, XLogP of 0.99, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)acetic acid;2-methylphenol is sourced from PubChem (CID 67651337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).