About 2-methylphenol;2H-triazole
2-methylphenol;2H-triazole (PubChem CID 161448699) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 2-methylphenol;2H-triazole.
Molecular Properties
| Compound Name | 2-methylphenol;2H-triazole |
| PubChem CID | 161448699 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 2-methylphenol;2H-triazole |
| SMILES | Cc1ccccc1O.c1cn[nH]n1 |
| InChI | InChI=1S/C7H8O.C2H3N3/c1-6-4-2-3-5-7(6)8;1-2-4-5-3-1/h2-5,8H,1H3;1-2H,(H,3,4,5) |
| InChIKey | WAFUAZOSPJSEDF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylphenol;2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylphenol;2H-triazole?
The IUPAC name of 2-methylphenol;2H-triazole (CID 161448699) is 2-methylphenol;2H-triazole.
What is the SMILES notation for 2-methylphenol;2H-triazole?
The canonical SMILES for 2-methylphenol;2H-triazole is Cc1ccccc1O.c1cn[nH]n1.
What is the InChIKey of 2-methylphenol;2H-triazole?
The InChIKey is WAFUAZOSPJSEDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C2H3N3/c1-6-4-2-3-5-7(6)8;1-2-4-5-3-1/h2-5,8H,1H3;1-2H,(H,3,4,5).
What are the key properties of 2-methylphenol;2H-triazole?
2-methylphenol;2H-triazole has a molecular weight of 177.21 g/mol, XLogP of 1.51, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylphenol;2H-triazole is sourced from PubChem (CID 161448699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).