About 2-methylphenol;2H-tetrazole
2-methylphenol;2H-tetrazole (PubChem CID 175440048) has the molecular formula C8H10N4O
and a molecular weight of 178.20 g/mol. Its IUPAC name is 2-methylphenol;2H-tetrazole.
Molecular Properties
| Compound Name | 2-methylphenol;2H-tetrazole |
| PubChem CID | 175440048 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2-methylphenol;2H-tetrazole |
| SMILES | Cc1ccccc1O.c1nn[nH]n1 |
| InChI | InChI=1S/C7H8O.CH2N4/c1-6-4-2-3-5-7(6)8;1-2-4-5-3-1/h2-5,8H,1H3;1H,(H,2,3,4,5) |
| InChIKey | KKFNCLHEULJVKV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylphenol;2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylphenol;2H-tetrazole?
The IUPAC name of 2-methylphenol;2H-tetrazole (CID 175440048) is 2-methylphenol;2H-tetrazole.
What is the SMILES notation for 2-methylphenol;2H-tetrazole?
The canonical SMILES for 2-methylphenol;2H-tetrazole is Cc1ccccc1O.c1nn[nH]n1.
What is the InChIKey of 2-methylphenol;2H-tetrazole?
The InChIKey is KKFNCLHEULJVKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.CH2N4/c1-6-4-2-3-5-7(6)8;1-2-4-5-3-1/h2-5,8H,1H3;1H,(H,2,3,4,5).
What are the key properties of 2-methylphenol;2H-tetrazole?
2-methylphenol;2H-tetrazole has a molecular weight of 178.20 g/mol, XLogP of 0.90, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylphenol;2H-tetrazole is sourced from PubChem (CID 175440048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).