About cyclohexane;2-methylphenol
cyclohexane;2-methylphenol (PubChem CID 70504255) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is cyclohexane;2-methylphenol.
Molecular Properties
| Compound Name | cyclohexane;2-methylphenol |
| PubChem CID | 70504255 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | cyclohexane;2-methylphenol |
| SMILES | C1CCCCC1.Cc1ccccc1O |
| InChI | InChI=1S/C7H8O.C6H12/c1-6-4-2-3-5-7(6)8;1-2-4-6-5-3-1/h2-5,8H,1H3;1-6H2 |
| InChIKey | SDODBBIOUMNXDH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexane;2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;2-methylphenol?
The IUPAC name of cyclohexane;2-methylphenol (CID 70504255) is cyclohexane;2-methylphenol.
What is the SMILES notation for cyclohexane;2-methylphenol?
The canonical SMILES for cyclohexane;2-methylphenol is C1CCCCC1.Cc1ccccc1O.
What is the InChIKey of cyclohexane;2-methylphenol?
The InChIKey is SDODBBIOUMNXDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H12/c1-6-4-2-3-5-7(6)8;1-2-4-6-5-3-1/h2-5,8H,1H3;1-6H2.
What are the key properties of cyclohexane;2-methylphenol?
cyclohexane;2-methylphenol has a molecular weight of 192.30 g/mol, XLogP of 4.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;2-methylphenol is sourced from PubChem (CID 70504255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).