About N-cyclohexylidenehydroxylamine;2-methylphenol
N-cyclohexylidenehydroxylamine;2-methylphenol (PubChem CID 87432171) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is N-cyclohexylidenehydroxylamine;2-methylphenol.
Molecular Properties
| Compound Name | N-cyclohexylidenehydroxylamine;2-methylphenol |
| PubChem CID | 87432171 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-cyclohexylidenehydroxylamine;2-methylphenol |
| SMILES | Cc1ccccc1O.ON=C1CCCCC1 |
| InChI | InChI=1S/C7H8O.C6H11NO/c1-6-4-2-3-5-7(6)8;8-7-6-4-2-1-3-5-6/h2-5,8H,1H3;8H,1-5H2 |
| InChIKey | QRZKJQNHMLYZKF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexylidenehydroxylamine;2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylidenehydroxylamine;2-methylphenol?
The IUPAC name of N-cyclohexylidenehydroxylamine;2-methylphenol (CID 87432171) is N-cyclohexylidenehydroxylamine;2-methylphenol.
What is the SMILES notation for N-cyclohexylidenehydroxylamine;2-methylphenol?
The canonical SMILES for N-cyclohexylidenehydroxylamine;2-methylphenol is Cc1ccccc1O.ON=C1CCCCC1.
What is the InChIKey of N-cyclohexylidenehydroxylamine;2-methylphenol?
The InChIKey is QRZKJQNHMLYZKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H11NO/c1-6-4-2-3-5-7(6)8;8-7-6-4-2-1-3-5-6/h2-5,8H,1H3;8H,1-5H2.
What are the key properties of N-cyclohexylidenehydroxylamine;2-methylphenol?
N-cyclohexylidenehydroxylamine;2-methylphenol has a molecular weight of 221.30 g/mol, XLogP of 3.48, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylidenehydroxylamine;2-methylphenol is sourced from PubChem (CID 87432171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).