About bicyclo[2.2.0]hexane;2-methylphenol
bicyclo[2.2.0]hexane;2-methylphenol (PubChem CID 70270584) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is bicyclo[2.2.0]hexane;2-methylphenol.
Molecular Properties
| Compound Name | bicyclo[2.2.0]hexane;2-methylphenol |
| PubChem CID | 70270584 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | bicyclo[2.2.0]hexane;2-methylphenol |
| SMILES | C1CC2CCC12.Cc1ccccc1O |
| InChI | InChI=1S/C7H8O.C6H10/c1-6-4-2-3-5-7(6)8;1-2-6-4-3-5(1)6/h2-5,8H,1H3;5-6H,1-4H2 |
| InChIKey | CBOBBXWEMMZMCM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bicyclo[2.2.0]hexane;2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexane;2-methylphenol?
The IUPAC name of bicyclo[2.2.0]hexane;2-methylphenol (CID 70270584) is bicyclo[2.2.0]hexane;2-methylphenol.
What is the SMILES notation for bicyclo[2.2.0]hexane;2-methylphenol?
The canonical SMILES for bicyclo[2.2.0]hexane;2-methylphenol is C1CC2CCC12.Cc1ccccc1O.
What is the InChIKey of bicyclo[2.2.0]hexane;2-methylphenol?
The InChIKey is CBOBBXWEMMZMCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H10/c1-6-4-2-3-5-7(6)8;1-2-6-4-3-5(1)6/h2-5,8H,1H3;5-6H,1-4H2.
What are the key properties of bicyclo[2.2.0]hexane;2-methylphenol?
bicyclo[2.2.0]hexane;2-methylphenol has a molecular weight of 190.29 g/mol, XLogP of 3.51, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexane;2-methylphenol is sourced from PubChem (CID 70270584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).