tripotassium;hydride;2-(methylamino)acetic acid

C3H10K3NO2 — CID 174232708

IUPACtripotassium;hydride;2-(methylamino)acetic acid
SMILESCNCC(=O)O.[H-].[H-].[H-].[K+].[K+].[K+]
InChIInChI=1S/C3H7NO2.3K.3H/c1-4-2-3(5)6;;;;;;/h4H,2H2,1H3,(H,5,6);;;;;;/q;3*+1;3*-1
InChIKeyLRKFYBWPEHZSML-UHFFFAOYSA-N
MW209.41 g/mol
LogP-9.36
Rot. Bonds2

About tripotassium;hydride;2-(methylamino)acetic acid

tripotassium;hydride;2-(methylamino)acetic acid (PubChem CID 174232708) has the molecular formula C3H10K3NO2 and a molecular weight of 209.41 g/mol. Its IUPAC name is tripotassium;hydride;2-(methylamino)acetic acid.

Molecular Properties

Compound Nametripotassium;hydride;2-(methylamino)acetic acid
PubChem CID174232708
Molecular FormulaC3H10K3NO2
Molecular Weight209.41 g/mol
Exact Mass208.96
IUPAC Nametripotassium;hydride;2-(methylamino)acetic acid
SMILESCNCC(=O)O.[H-].[H-].[H-].[K+].[K+].[K+]
InChIInChI=1S/C3H7NO2.3K.3H/c1-4-2-3(5)6;;;;;;/h4H,2H2,1H3,(H,5,6);;;;;;/q;3*+1;3*-1
InChIKeyLRKFYBWPEHZSML-UHFFFAOYSA-N
XLogP-9.36
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.41
LogP ≤ 5-9.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze tripotassium;hydride;2-(methylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tripotassium;hydride;2-(methylamino)acetic acid?
The IUPAC name of tripotassium;hydride;2-(methylamino)acetic acid (CID 174232708) is tripotassium;hydride;2-(methylamino)acetic acid.
What is the SMILES notation for tripotassium;hydride;2-(methylamino)acetic acid?
The canonical SMILES for tripotassium;hydride;2-(methylamino)acetic acid is CNCC(=O)O.[H-].[H-].[H-].[K+].[K+].[K+].
What is the InChIKey of tripotassium;hydride;2-(methylamino)acetic acid?
The InChIKey is LRKFYBWPEHZSML-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.3K.3H/c1-4-2-3(5)6;;;;;;/h4H,2H2,1H3,(H,5,6);;;;;;/q;3*+1;3*-1.
What are the key properties of tripotassium;hydride;2-(methylamino)acetic acid?
tripotassium;hydride;2-(methylamino)acetic acid has a molecular weight of 209.41 g/mol, XLogP of -9.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tripotassium;hydride;2-(methylamino)acetic acid is sourced from PubChem (CID 174232708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).