C11H21NO8 — CID 137371876
2,2-diethoxybutanedioic acid;2-(methylamino)acetic acid (PubChem CID 137371876) has the molecular formula C11H21NO8 and a molecular weight of 295.29 g/mol. Its IUPAC name is 2,2-diethoxybutanedioic acid;2-(methylamino)acetic acid.
| Compound Name | 2,2-diethoxybutanedioic acid;2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 137371876 |
| Molecular Formula | C11H21NO8 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2,2-diethoxybutanedioic acid;2-(methylamino)acetic acid |
| SMILES | CCOC(CC(=O)O)(OCC)C(=O)O.CNCC(=O)O |
| InChI | InChI=1S/C8H14O6.C3H7NO2/c1-3-13-8(7(11)12,14-4-2)5-6(9)10;1-4-2-3(5)6/h3-5H2,1-2H3,(H,9,10)(H,11,12);4H,2H2,1H3,(H,5,6) |
| InChIKey | PEKUWXCJZJWDLG-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|